C7H2F12O — CID 142425781
1,1,1,3,4,4,5,5,5-nonafluoro-2-(2,2,2-trifluoroethoxy)pent-2-ene (PubChem CID 142425781) has the molecular formula C7H2F12O and a molecular weight of 330.07 g/mol. Its IUPAC name is 1,1,1,3,4,4,5,5,5-nonafluoro-2-(2,2,2-trifluoroethoxy)pent-2-ene.
| Compound Name | 1,1,1,3,4,4,5,5,5-nonafluoro-2-(2,2,2-trifluoroethoxy)pent-2-ene |
|---|---|
| PubChem CID | 142425781 |
| Molecular Formula | C7H2F12O |
| Molecular Weight | 330.07 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 1,1,1,3,4,4,5,5,5-nonafluoro-2-(2,2,2-trifluoroethoxy)pent-2-ene |
| SMILES | FC(=C(OCC(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H2F12O/c8-2(5(12,13)7(17,18)19)3(6(14,15)16)20-1-4(9,10)11/h1H2 |
| InChIKey | NHKHBHKQOBLZEJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.07 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|