C17H28N2 — CID 142428648
N-[(4Z,6Z)-4-ethyl-6,8-dimethyl-7-[(methylideneamino)methyl]nona-1,4,6-trien-2-yl]ethanimine (PubChem CID 142428648) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is N-[(4Z,6Z)-4-ethyl-6,8-dimethyl-7-[(methylideneamino)methyl]nona-1,4,6-trien-2-yl]ethanimine.
| Compound Name | N-[(4Z,6Z)-4-ethyl-6,8-dimethyl-7-[(methylideneamino)methyl]nona-1,4,6-trien-2-yl]ethanimine |
|---|---|
| PubChem CID | 142428648 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-[(4Z,6Z)-4-ethyl-6,8-dimethyl-7-[(methylideneamino)methyl]nona-1,4,6-trien-2-yl]ethanimine |
| SMILES | C=NC/C(=C(C)\C=C(\CC)CC(=C)/N=C/C)C(C)C |
| InChI | InChI=1S/C17H28N2/c1-8-16(11-15(6)19-9-2)10-14(5)17(12-18-7)13(3)4/h9-10,13H,6-8,11-12H2,1-5H3/b16-10-,17-14+,19-9+ |
| InChIKey | PLUPTHMTKJYXSC-PGWXBAKCSA-N |
| XLogP | 4.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|