C32H26F5N3O6 — CID 142428785
ethyl 3-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate (PubChem CID 142428785) has the molecular formula C32H26F5N3O6 and a molecular weight of 643.57 g/mol. Its IUPAC name is ethyl 3-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate.
| Compound Name | ethyl 3-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate |
|---|---|
| PubChem CID | 142428785 |
| Molecular Formula | C32H26F5N3O6 |
| Molecular Weight | 643.57 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | ethyl 3-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate |
| SMILES | CCOC(=O)c1cccc(O[C@@H]2CCCc3c(C(F)(F)F)nn(-c4cccc(C(=O)N(C)c5ccc6c(c5)OC(F)(F)O6)c4)c32)c1 |
| InChI | InChI=1S/C32H26F5N3O6/c1-3-43-30(42)19-8-5-10-22(16-19)44-25-12-6-11-23-27(25)40(38-28(23)31(33,34)35)21-9-4-7-18(15-21)29(41)39(2)20-13-14-24-26(17-20)46-32(36,37)45-24/h4-5,7-10,13-17,25H,3,6,11-12H2,1-2H3/t25-/m1/s1 |
| InChIKey | CQUAGXWNVVUFIV-RUZDIDTESA-N |
| XLogP | 7.12 |
| TPSA | 92.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |