C23H19F5N2O4 — CID 170431846
1-[3-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-ol (PubChem CID 170431846) has the molecular formula C23H19F5N2O4 and a molecular weight of 482.41 g/mol. Its IUPAC name is 1-[3-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-ol.
| Compound Name | 1-[3-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-ol |
|---|---|
| PubChem CID | 170431846 |
| Molecular Formula | C23H19F5N2O4 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-[3-[(1R)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-ol |
| SMILES | C[C@@H](Oc1cccc(-n2nc(C(F)(F)F)c3c2C(O)CCC3)c1)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C23H19F5N2O4/c1-12(13-8-9-18-19(10-13)34-23(27,28)33-18)32-15-5-2-4-14(11-15)30-20-16(6-3-7-17(20)31)21(29-30)22(24,25)26/h2,4-5,8-12,17,31H,3,6-7H2,1H3/t12-,17?/m1/s1 |
| InChIKey | ARWQELQQYZVKSE-MTATWXBHSA-N |
| XLogP | 5.72 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |