C29H27F6N3O6 — CID 170619640
4-[[(7R)-1-[5-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-6-fluoro-3-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]cyclohexane-1-carboxylic acid (PubChem CID 170619640) has the molecular formula C29H27F6N3O6 and a molecular weight of 627.54 g/mol. Its IUPAC name is 4-[[(7R)-1-[5-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-6-fluoro-3-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(7R)-1-[5-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-6-fluoro-3-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 170619640 |
| Molecular Formula | C29H27F6N3O6 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | 4-[[(7R)-1-[5-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-6-fluoro-3-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]cyclohexane-1-carboxylic acid |
| SMILES | C[C@H](Oc1cc(-n2nc(C(F)(F)F)c3c2[C@H](OC2CCC(C(=O)O)CC2)CCC3)cnc1F)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C29H27F6N3O6/c1-14(16-7-10-20-22(11-16)44-29(34,35)43-20)41-23-12-17(13-36-26(23)30)38-24-19(25(37-38)28(31,32)33)3-2-4-21(24)42-18-8-5-15(6-9-18)27(39)40/h7,10-15,18,21H,2-6,8-9H2,1H3,(H,39,40)/t14-,15?,18?,21+/m0/s1 |
| InChIKey | ZKRXUGFPLITMOI-QMLWVGJDSA-N |
| XLogP | 6.92 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|