C30H26F5N5O4 — CID 170432909
methyl 4-[[(7S)-1-[2-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethylamino]-4-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]amino]benzoate (PubChem CID 170432909) has the molecular formula C30H26F5N5O4 and a molecular weight of 615.56 g/mol. Its IUPAC name is methyl 4-[[(7S)-1-[2-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethylamino]-4-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]amino]benzoate.
| Compound Name | methyl 4-[[(7S)-1-[2-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethylamino]-4-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]amino]benzoate |
|---|---|
| PubChem CID | 170432909 |
| Molecular Formula | C30H26F5N5O4 |
| Molecular Weight | 615.56 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | methyl 4-[[(7S)-1-[2-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethylamino]-4-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N[C@H]2CCCc3c(C(F)(F)F)nn(-c4ccnc(NC(C)c5ccc6c(c5)OC(F)(F)O6)c4)c32)cc1 |
| InChI | InChI=1S/C30H26F5N5O4/c1-16(18-8-11-23-24(14-18)44-30(34,35)43-23)37-25-15-20(12-13-36-25)40-26-21(27(39-40)29(31,32)33)4-3-5-22(26)38-19-9-6-17(7-10-19)28(41)42-2/h6-16,22,38H,3-5H2,1-2H3,(H,36,37)/t16?,22-/m0/s1 |
| InChIKey | AHHOQWPRUQYANK-XLDIYJRPSA-N |
| XLogP | 7.06 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |