C23H18F6N2O4 — CID 170431754
(7R)-1-[3-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-4-fluorophenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-ol (PubChem CID 170431754) has the molecular formula C23H18F6N2O4 and a molecular weight of 500.40 g/mol. Its IUPAC name is (7R)-1-[3-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-4-fluorophenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-ol.
| Compound Name | (7R)-1-[3-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-4-fluorophenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-ol |
|---|---|
| PubChem CID | 170431754 |
| Molecular Formula | C23H18F6N2O4 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | (7R)-1-[3-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-4-fluorophenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-ol |
| SMILES | CC(Oc1cc(-n2nc(C(F)(F)F)c3c2[C@H](O)CCC3)ccc1F)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C23H18F6N2O4/c1-11(12-5-8-17-19(9-12)35-23(28,29)34-17)33-18-10-13(6-7-15(18)24)31-20-14(3-2-4-16(20)32)21(30-31)22(25,26)27/h5-11,16,32H,2-4H2,1H3/t11?,16-/m1/s1 |
| InChIKey | KXZKQWLOFZQHJC-WVQRXBFSSA-N |
| XLogP | 5.86 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |