C30H22F5N3O6 — CID 142428844
4-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid (PubChem CID 142428844) has the molecular formula C30H22F5N3O6 and a molecular weight of 615.51 g/mol. Its IUPAC name is 4-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid.
| Compound Name | 4-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 142428844 |
| Molecular Formula | C30H22F5N3O6 |
| Molecular Weight | 615.51 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | 4-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid |
| SMILES | CN(C(=O)c1cccc(-n2nc(C(F)(F)F)c3c2[C@H](Oc2ccc(C(=O)O)cc2)CCC3)c1)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C30H22F5N3O6/c1-37(18-10-13-22-24(15-18)44-30(34,35)43-22)27(39)17-4-2-5-19(14-17)38-25-21(26(36-38)29(31,32)33)6-3-7-23(25)42-20-11-8-16(9-12-20)28(40)41/h2,4-5,8-15,23H,3,6-7H2,1H3,(H,40,41)/t23-/m1/s1 |
| InChIKey | LGCLACSGYALGRU-HSZRJFAPSA-N |
| XLogP | 6.64 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |