C29H24F2N4O6 — CID 159372280
6-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-methyl-4,5,6,7-tetrahydroindazol-7-yl]oxy]pyridine-3-carboxylic acid (PubChem CID 159372280) has the molecular formula C29H24F2N4O6 and a molecular weight of 562.53 g/mol. Its IUPAC name is 6-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-methyl-4,5,6,7-tetrahydroindazol-7-yl]oxy]pyridine-3-carboxylic acid.
| Compound Name | 6-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-methyl-4,5,6,7-tetrahydroindazol-7-yl]oxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159372280 |
| Molecular Formula | C29H24F2N4O6 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 6-[[(7R)-1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)-methylcarbamoyl]phenyl]-3-methyl-4,5,6,7-tetrahydroindazol-7-yl]oxy]pyridine-3-carboxylic acid |
| SMILES | Cc1nn(-c2cccc(C(=O)N(C)c3ccc4c(c3)OC(F)(F)O4)c2)c2c1CCC[C@H]2Oc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C29H24F2N4O6/c1-16-21-7-4-8-23(39-25-12-9-18(15-32-25)28(37)38)26(21)35(33-16)20-6-3-5-17(13-20)27(36)34(2)19-10-11-22-24(14-19)41-29(30,31)40-22/h3,5-6,9-15,23H,4,7-8H2,1-2H3,(H,37,38)/t23-/m1/s1 |
| InChIKey | LJWVWGONNXSREZ-HSZRJFAPSA-N |
| XLogP | 5.33 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |