C34H31F4N3O6 — CID 155051103
tert-butyl 4-[[1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylcarbamoyl]phenyl]-3-(difluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate (PubChem CID 155051103) has the molecular formula C34H31F4N3O6 and a molecular weight of 653.63 g/mol. Its IUPAC name is tert-butyl 4-[[1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylcarbamoyl]phenyl]-3-(difluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate.
| Compound Name | tert-butyl 4-[[1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylcarbamoyl]phenyl]-3-(difluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate |
|---|---|
| PubChem CID | 155051103 |
| Molecular Formula | C34H31F4N3O6 |
| Molecular Weight | 653.63 g/mol |
| Exact Mass | 653.21 |
| IUPAC Name | tert-butyl 4-[[1-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylcarbamoyl]phenyl]-3-(difluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(OC2CCCc3c(C(F)F)nn(-c4cccc(C(=O)NCc5ccc6c(c5)OC(F)(F)O6)c4)c32)cc1 |
| InChI | InChI=1S/C34H31F4N3O6/c1-33(2,3)47-32(43)20-11-13-23(14-12-20)44-26-9-5-8-24-28(30(35)36)40-41(29(24)26)22-7-4-6-21(17-22)31(42)39-18-19-10-15-25-27(16-19)46-34(37,38)45-25/h4,6-7,10-17,26,30H,5,8-9,18H2,1-3H3,(H,39,42) |
| InChIKey | QHMQPSKECFDKSU-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.63 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |