C31H29F5N4O5 — CID 170619718
4-[[1-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylamino]-4-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid;propane (PubChem CID 170619718) has the molecular formula C31H29F5N4O5 and a molecular weight of 632.59 g/mol. Its IUPAC name is 4-[[1-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylamino]-4-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid;propane.
| Compound Name | 4-[[1-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylamino]-4-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid;propane |
|---|---|
| PubChem CID | 170619718 |
| Molecular Formula | C31H29F5N4O5 |
| Molecular Weight | 632.59 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | 4-[[1-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylamino]-4-pyridinyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid;propane |
| SMILES | CCC.O=C(O)c1ccc(OC2CCCc3c(C(F)(F)F)nn(-c4ccnc(NCc5ccc6c(c5)OC(F)(F)O6)c4)c32)cc1 |
| InChI | InChI=1S/C28H21F5N4O5.C3H8/c29-27(30,31)25-19-2-1-3-21(40-18-7-5-16(6-8-18)26(38)39)24(19)37(36-25)17-10-11-34-23(13-17)35-14-15-4-9-20-22(12-15)42-28(32,33)41-20;1-3-2/h4-13,21H,1-3,14H2,(H,34,35)(H,38,39);3H2,1-2H3 |
| InChIKey | WCCNNLYUPHSJIQ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.59 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |