C30H32F4N4O4 — CID 170619578
N-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-fluoro-5-[7-[4-(nitrosomethyl)pent-4-en-2-yloxy]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline (PubChem CID 170619578) has the molecular formula C30H32F4N4O4 and a molecular weight of 588.60 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-fluoro-5-[7-[4-(nitrosomethyl)pent-4-en-2-yloxy]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline.
| Compound Name | N-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-fluoro-5-[7-[4-(nitrosomethyl)pent-4-en-2-yloxy]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline |
|---|---|
| PubChem CID | 170619578 |
| Molecular Formula | C30H32F4N4O4 |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-fluoro-5-[7-[4-(nitrosomethyl)pent-4-en-2-yloxy]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline |
| SMILES | C=C(CN=O)CC(C)OC1CCCc2c(C(F)(F)F)nn(-c3ccc(F)c(NCc4ccc5c(c4)OC(C)(C)O5)c3)c21 |
| InChI | InChI=1S/C30H32F4N4O4/c1-17(15-36-39)12-18(2)40-25-7-5-6-21-27(25)38(37-28(21)30(32,33)34)20-9-10-22(31)23(14-20)35-16-19-8-11-24-26(13-19)42-29(3,4)41-24/h8-11,13-14,18,25,35H,1,5-7,12,15-16H2,2-4H3 |
| InChIKey | NCBKPJRVMDKIPF-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|