C14H13F3O4 — CID 142428793
3-phenylmethoxy-5-(2,2,2-trifluoroacetyl)oxan-4-one (PubChem CID 142428793) has the molecular formula C14H13F3O4 and a molecular weight of 302.25 g/mol. Its IUPAC name is 3-phenylmethoxy-5-(2,2,2-trifluoroacetyl)oxan-4-one.
| Compound Name | 3-phenylmethoxy-5-(2,2,2-trifluoroacetyl)oxan-4-one |
|---|---|
| PubChem CID | 142428793 |
| Molecular Formula | C14H13F3O4 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-phenylmethoxy-5-(2,2,2-trifluoroacetyl)oxan-4-one |
| SMILES | O=C1C(OCc2ccccc2)COCC1C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13F3O4/c15-14(16,17)13(19)10-7-20-8-11(12(10)18)21-6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2 |
| InChIKey | VDFOVJYJJUEORS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|