C10H14N4O2 — CID 142433669
[(Z)-2-[methyl-(methylideneamino)amino]but-2-enyl] imidazole-1-carboxylate (PubChem CID 142433669) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is [(Z)-2-[methyl-(methylideneamino)amino]but-2-enyl] imidazole-1-carboxylate.
| Compound Name | [(Z)-2-[methyl-(methylideneamino)amino]but-2-enyl] imidazole-1-carboxylate |
|---|---|
| PubChem CID | 142433669 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [(Z)-2-[methyl-(methylideneamino)amino]but-2-enyl] imidazole-1-carboxylate |
| SMILES | C=NN(C)/C(=C\C)COC(=O)n1ccnc1 |
| InChI | InChI=1S/C10H14N4O2/c1-4-9(13(3)11-2)7-16-10(15)14-6-5-12-8-14/h4-6,8H,2,7H2,1,3H3/b9-4- |
| InChIKey | KQHJIHMDRYGEMI-WTKPLQERSA-N |
| XLogP | 1.32 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|