C16H23ClF3N3OSi — CID 142436014
6-chloro-N-ethyl-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 142436014) has the molecular formula C16H23ClF3N3OSi and a molecular weight of 393.91 g/mol. Its IUPAC name is 6-chloro-N-ethyl-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 6-chloro-N-ethyl-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 142436014 |
| Molecular Formula | C16H23ClF3N3OSi |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 6-chloro-N-ethyl-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CCNc1cc(Cl)nc2c1c(C(F)(F)F)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H23ClF3N3OSi/c1-5-21-12-8-13(17)22-15-14(12)11(16(18,19)20)9-23(15)10-24-6-7-25(2,3)4/h8-9H,5-7,10H2,1-4H3,(H,21,22) |
| InChIKey | ACUIBCQQKHSGRK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|