About 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane
1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane (PubChem CID 142436114) has the molecular formula C13H27NO4S
and a molecular weight of 293.43 g/mol. Its IUPAC name is 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane.
Molecular Properties
| Compound Name | 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane |
| PubChem CID | 142436114 |
| Molecular Formula | C13H27NO4S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane |
| SMILES | CC.CCC(CC)C(=O)OC(C)OC(=O)SCCN |
| InChI | InChI=1S/C11H21NO4S.C2H6/c1-4-9(5-2)10(13)15-8(3)16-11(14)17-7-6-12;1-2/h8-9H,4-7,12H2,1-3H3;1-2H3 |
| InChIKey | WHRBCAJPYUDCMU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane?
The IUPAC name of 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane (CID 142436114) is 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane.
What is the SMILES notation for 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane?
The canonical SMILES for 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane is CC.CCC(CC)C(=O)OC(C)OC(=O)SCCN.
What is the InChIKey of 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane?
The InChIKey is WHRBCAJPYUDCMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4S.C2H6/c1-4-9(5-2)10(13)15-8(3)16-11(14)17-7-6-12;1-2/h8-9H,4-7,12H2,1-3H3;1-2H3.
What are the key properties of 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane?
1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane has a molecular weight of 293.43 g/mol, XLogP of 3.17, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethylsulfanylcarbonyloxy)ethyl 2-ethylbutanoate;ethane is sourced from PubChem (CID 142436114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).