C19H32O8S — CID 159609308
[(1S)-1-[4-[(1R)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylsulfanylbutanoyloxy]ethyl] 2,2-dimethylpropanoate (PubChem CID 159609308) has the molecular formula C19H32O8S and a molecular weight of 420.52 g/mol. Its IUPAC name is [(1S)-1-[4-[(1R)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylsulfanylbutanoyloxy]ethyl] 2,2-dimethylpropanoate.
| Compound Name | [(1S)-1-[4-[(1R)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylsulfanylbutanoyloxy]ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159609308 |
| Molecular Formula | C19H32O8S |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(1S)-1-[4-[(1R)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylsulfanylbutanoyloxy]ethyl] 2,2-dimethylpropanoate |
| SMILES | C[C@@H](OC(=O)CCCSC(=O)O[C@H](C)OC(=O)C(C)(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H32O8S/c1-12(25-15(21)18(3,4)5)24-14(20)10-9-11-28-17(23)27-13(2)26-16(22)19(6,7)8/h12-13H,9-11H2,1-8H3/t12-,13+/m0/s1 |
| InChIKey | ZWMQHIDNOYRYGQ-QWHCGFSZSA-N |
| XLogP | 4.05 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|