C33H44N2O11 — CID 142436975
[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] (2S)-6-[(6-oxo-6-phenylmethoxyhexanoyl)amino]-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 142436975) has the molecular formula C33H44N2O11 and a molecular weight of 644.72 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] (2S)-6-[(6-oxo-6-phenylmethoxyhexanoyl)amino]-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | [(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] (2S)-6-[(6-oxo-6-phenylmethoxyhexanoyl)amino]-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 142436975 |
| Molecular Formula | C33H44N2O11 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] (2S)-6-[(6-oxo-6-phenylmethoxyhexanoyl)amino]-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | C[C@@H]1O[C@@H](OC(=O)[C@H](CCCCNC(=O)CCCCC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H44N2O11/c1-22-28(38)29(39)30(40)32(45-22)46-31(41)25(35-33(42)44-21-24-14-6-3-7-15-24)16-10-11-19-34-26(36)17-8-9-18-27(37)43-20-23-12-4-2-5-13-23/h2-7,12-15,22,25,28-30,32,38-40H,8-11,16-21H2,1H3,(H,34,36)(H,35,42)/t22-,25-,28+,29+,30-,32-/m0/s1 |
| InChIKey | IKDLBUUJDLKOMN-LLUBFZIJSA-N |
| XLogP | 2.24 |
| TPSA | 189.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|