C23H42FN3O6 — CID 142440996
hexyl N-(5-fluoro-1-methyl-2-oxopyrimidin-4-yl)carbamate;methyl acetate;2-methyl-1-propoxybutane (PubChem CID 142440996) has the molecular formula C23H42FN3O6 and a molecular weight of 475.60 g/mol. Its IUPAC name is hexyl N-(5-fluoro-1-methyl-2-oxopyrimidin-4-yl)carbamate;methyl acetate;2-methyl-1-propoxybutane.
| Compound Name | hexyl N-(5-fluoro-1-methyl-2-oxopyrimidin-4-yl)carbamate;methyl acetate;2-methyl-1-propoxybutane |
|---|---|
| PubChem CID | 142440996 |
| Molecular Formula | C23H42FN3O6 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | hexyl N-(5-fluoro-1-methyl-2-oxopyrimidin-4-yl)carbamate;methyl acetate;2-methyl-1-propoxybutane |
| SMILES | CCCCCCOC(=O)Nc1nc(=O)n(C)cc1F.CCCOCC(C)CC.COC(C)=O |
| InChI | InChI=1S/C12H18FN3O3.C8H18O.C3H6O2/c1-3-4-5-6-7-19-12(18)15-10-9(13)8-16(2)11(17)14-10;1-4-6-9-7-8(3)5-2;1-3(4)5-2/h8H,3-7H2,1-2H3,(H,14,15,17,18);8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | NTHZWBQCKOXFML-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|