C19H32FN3O6 — CID 142441017
dimethyl carbonate;5-fluoro-4-(1-methoxyethenylamino)-1-[(2S)-2-(2-methylbutoxy)butyl]pyrimidin-2-one (PubChem CID 142441017) has the molecular formula C19H32FN3O6 and a molecular weight of 417.48 g/mol. Its IUPAC name is dimethyl carbonate;5-fluoro-4-(1-methoxyethenylamino)-1-[(2S)-2-(2-methylbutoxy)butyl]pyrimidin-2-one.
| Compound Name | dimethyl carbonate;5-fluoro-4-(1-methoxyethenylamino)-1-[(2S)-2-(2-methylbutoxy)butyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 142441017 |
| Molecular Formula | C19H32FN3O6 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | dimethyl carbonate;5-fluoro-4-(1-methoxyethenylamino)-1-[(2S)-2-(2-methylbutoxy)butyl]pyrimidin-2-one |
| SMILES | C=C(Nc1nc(=O)n(C[C@H](CC)OCC(C)CC)cc1F)OC.COC(=O)OC |
| InChI | InChI=1S/C16H26FN3O3.C3H6O3/c1-6-11(3)10-23-13(7-2)8-20-9-14(17)15(19-16(20)21)18-12(4)22-5;1-5-3(4)6-2/h9,11,13H,4,6-8,10H2,1-3,5H3,(H,18,19,21);1-2H3/t11?,13-;/m0./s1 |
| InChIKey | NQXPSASKFGXFOG-IYWIJXFJSA-N |
| XLogP | 3.15 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|