C25H24N2O3 — CID 142448433
(4aR,7aS)-2-[(2-hydroxyphenyl)methyl]-6-(naphthalen-1-ylmethyl)-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 142448433) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is (4aR,7aS)-2-[(2-hydroxyphenyl)methyl]-6-(naphthalen-1-ylmethyl)-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | (4aR,7aS)-2-[(2-hydroxyphenyl)methyl]-6-(naphthalen-1-ylmethyl)-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 142448433 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (4aR,7aS)-2-[(2-hydroxyphenyl)methyl]-6-(naphthalen-1-ylmethyl)-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1[C@H]2NC(Cc3ccccc3O)CC[C@H]2C(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C25H24N2O3/c28-22-11-4-2-7-17(22)14-19-12-13-21-23(26-19)25(30)27(24(21)29)15-18-9-5-8-16-6-1-3-10-20(16)18/h1-11,19,21,23,26,28H,12-15H2/t19?,21-,23+/m1/s1 |
| InChIKey | ULSPPIKCQFAYLX-LVPCDLKWSA-N |
| XLogP | 3.39 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|