C20H11ClF9N5O3S — CID 142448843
2-chloro-N-(1-cyanocyclopropyl)-5-[3-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]thiophene-3-carboxamide (PubChem CID 142448843) has the molecular formula C20H11ClF9N5O3S and a molecular weight of 607.84 g/mol. Its IUPAC name is 2-chloro-N-(1-cyanocyclopropyl)-5-[3-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]thiophene-3-carboxamide.
| Compound Name | 2-chloro-N-(1-cyanocyclopropyl)-5-[3-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 142448843 |
| Molecular Formula | C20H11ClF9N5O3S |
| Molecular Weight | 607.84 g/mol |
| Exact Mass | 607.01 |
| IUPAC Name | 2-chloro-N-(1-cyanocyclopropyl)-5-[3-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]thiophene-3-carboxamide |
| SMILES | Cn1nc(OC(F)(F)C(F)C(F)(F)F)c(C(F)(F)F)c1-c1cc(-c2cc(C(=O)NC3(C#N)CC3)c(Cl)s2)on1 |
| InChI | InChI=1S/C20H11ClF9N5O3S/c1-35-12(11(18(23,24)25)15(33-35)37-20(29,30)16(22)19(26,27)28)8-5-9(38-34-8)10-4-7(13(21)39-10)14(36)32-17(6-31)2-3-17/h4-5,16H,2-3H2,1H3,(H,32,36) |
| InChIKey | BOIGEYICOJMCBV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |