C21H17F6N5O3S — CID 161338264
2-cyano-N-cyclopropyl-5-[3-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazol-5-yl]-1,2-oxazol-5-yl]-N-methylthiophene-3-carboxamide (PubChem CID 161338264) has the molecular formula C21H17F6N5O3S and a molecular weight of 533.45 g/mol. Its IUPAC name is 2-cyano-N-cyclopropyl-5-[3-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazol-5-yl]-1,2-oxazol-5-yl]-N-methylthiophene-3-carboxamide.
| Compound Name | 2-cyano-N-cyclopropyl-5-[3-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazol-5-yl]-1,2-oxazol-5-yl]-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 161338264 |
| Molecular Formula | C21H17F6N5O3S |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 2-cyano-N-cyclopropyl-5-[3-[3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazol-5-yl]-1,2-oxazol-5-yl]-N-methylthiophene-3-carboxamide |
| SMILES | Cc1c(OC(F)(F)C(F)C(F)(F)F)nn(C)c1-c1cc(-c2cc(C(=O)N(C)C3CC3)c(C#N)s2)on1 |
| InChI | InChI=1S/C21H17F6N5O3S/c1-9-16(32(3)29-17(9)34-21(26,27)19(22)20(23,24)25)12-7-13(35-30-12)14-6-11(15(8-28)36-14)18(33)31(2)10-4-5-10/h6-7,10,19H,4-5H2,1-3H3 |
| InChIKey | VMIDXJPJPMIZKK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 97.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |