C22H15ClF10N4O5S — CID 142500960
[5-[5-[4-chloro-3-[cyclopropyl(methyl)carbamoyl]phenyl]-1,2-oxazol-3-yl]-1-methyl-4-(trifluoromethyl)pyrazol-3-yl] 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate (PubChem CID 142500960) has the molecular formula C22H15ClF10N4O5S and a molecular weight of 672.89 g/mol. Its IUPAC name is [5-[5-[4-chloro-3-[cyclopropyl(methyl)carbamoyl]phenyl]-1,2-oxazol-3-yl]-1-methyl-4-(trifluoromethyl)pyrazol-3-yl] 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate.
| Compound Name | [5-[5-[4-chloro-3-[cyclopropyl(methyl)carbamoyl]phenyl]-1,2-oxazol-3-yl]-1-methyl-4-(trifluoromethyl)pyrazol-3-yl] 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate |
|---|---|
| PubChem CID | 142500960 |
| Molecular Formula | C22H15ClF10N4O5S |
| Molecular Weight | 672.89 g/mol |
| Exact Mass | 672.03 |
| IUPAC Name | [5-[5-[4-chloro-3-[cyclopropyl(methyl)carbamoyl]phenyl]-1,2-oxazol-3-yl]-1-methyl-4-(trifluoromethyl)pyrazol-3-yl] 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate |
| SMILES | CN(C(=O)c1cc(-c2cc(-c3c(C(F)(F)F)c(OS(=O)(=O)C(F)(C(F)(F)F)C(F)(F)F)nn3C)no2)ccc1Cl)C1CC1 |
| InChI | InChI=1S/C22H15ClF10N4O5S/c1-36(10-4-5-10)18(38)11-7-9(3-6-12(11)23)14-8-13(35-41-14)16-15(19(24,25)26)17(34-37(16)2)42-43(39,40)20(27,21(28,29)30)22(31,32)33/h3,6-8,10H,4-5H2,1-2H3 |
| InChIKey | JNIBYASZIJLPJE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 107.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.89 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|