C25H16ClF8N5O2 — CID 126498354
2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-(1-pyridin-2-ylcyclopropyl)benzamide (PubChem CID 126498354) has the molecular formula C25H16ClF8N5O2 and a molecular weight of 605.87 g/mol. Its IUPAC name is 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-(1-pyridin-2-ylcyclopropyl)benzamide.
| Compound Name | 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-(1-pyridin-2-ylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 126498354 |
| Molecular Formula | C25H16ClF8N5O2 |
| Molecular Weight | 605.87 g/mol |
| Exact Mass | 605.09 |
| IUPAC Name | 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-(1-pyridin-2-ylcyclopropyl)benzamide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-c1cc(-c2ccc(Cl)c(C(=O)NC3(c4ccccn4)CC3)c2)on1 |
| InChI | InChI=1S/C25H16ClF8N5O2/c1-39-19(18(24(29,30)31)20(37-39)23(27,28)25(32,33)34)15-11-16(41-38-15)12-5-6-14(26)13(10-12)21(40)36-22(7-8-22)17-4-2-3-9-35-17/h2-6,9-11H,7-8H2,1H3,(H,36,40) |
| InChIKey | OSWHJBCYLATCGU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.87 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|