C16H7ClF8N4O3 — CID 129113643
2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2,4-oxadiazol-5-yl]benzoic acid (PubChem CID 129113643) has the molecular formula C16H7ClF8N4O3 and a molecular weight of 490.69 g/mol. Its IUPAC name is 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2,4-oxadiazol-5-yl]benzoic acid.
| Compound Name | 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2,4-oxadiazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 129113643 |
| Molecular Formula | C16H7ClF8N4O3 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2,4-oxadiazol-5-yl]benzoic acid |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-c1noc(-c2ccc(Cl)c(C(=O)O)c2)n1 |
| InChI | InChI=1S/C16H7ClF8N4O3/c1-29-9(8(15(20,21)22)10(27-29)14(18,19)16(23,24)25)11-26-12(32-28-11)5-2-3-7(17)6(4-5)13(30)31/h2-4H,1H3,(H,30,31) |
| InChIKey | JKRUOMGQYRXDQM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|