C21H13ClF7NO3 — CID 118065579
2-chloro-5-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2-oxazol-5-yl]benzoic acid (PubChem CID 118065579) has the molecular formula C21H13ClF7NO3 and a molecular weight of 495.78 g/mol. Its IUPAC name is 2-chloro-5-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2-oxazol-5-yl]benzoic acid.
| Compound Name | 2-chloro-5-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2-oxazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 118065579 |
| Molecular Formula | C21H13ClF7NO3 |
| Molecular Weight | 495.78 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 2-chloro-5-[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1,2-oxazol-5-yl]benzoic acid |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1-c1cc(-c2ccc(Cl)c(C(=O)O)c2)on1 |
| InChI | InChI=1S/C21H13ClF7NO3/c1-9-5-12(19(23,20(24,25)26)21(27,28)29)6-10(2)17(9)15-8-16(33-30-15)11-3-4-14(22)13(7-11)18(31)32/h3-8H,1-2H3,(H,31,32) |
| InChIKey | ORQDBFJWGZWESX-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.78 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |