C20H15ClF8N4O2 — CID 126498287
2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-propan-2-ylbenzamide (PubChem CID 126498287) has the molecular formula C20H15ClF8N4O2 and a molecular weight of 530.80 g/mol. Its IUPAC name is 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-propan-2-ylbenzamide.
| Compound Name | 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 126498287 |
| Molecular Formula | C20H15ClF8N4O2 |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cc(-c2cc(-c3c(C(F)(F)F)c(C(F)(F)C(F)(F)F)nn3C)no2)ccc1Cl |
| InChI | InChI=1S/C20H15ClF8N4O2/c1-8(2)30-17(34)10-6-9(4-5-11(10)21)13-7-12(32-35-13)15-14(19(24,25)26)16(31-33(15)3)18(22,23)20(27,28)29/h4-8H,1-3H3,(H,30,34) |
| InChIKey | ZMCRJXNBKMKICB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|