C21H18ClF8N5O2S — CID 167067602
5-[(Z)-1-aminooxy-3-[2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-3-yl]prop-1-enyl]-N-(1-carbamothioylcyclopropyl)-2-chlorobenzamide (PubChem CID 167067602) has the molecular formula C21H18ClF8N5O2S and a molecular weight of 591.91 g/mol. Its IUPAC name is 5-[(Z)-1-aminooxy-3-[2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-3-yl]prop-1-enyl]-N-(1-carbamothioylcyclopropyl)-2-chlorobenzamide.
| Compound Name | 5-[(Z)-1-aminooxy-3-[2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-3-yl]prop-1-enyl]-N-(1-carbamothioylcyclopropyl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 167067602 |
| Molecular Formula | C21H18ClF8N5O2S |
| Molecular Weight | 591.91 g/mol |
| Exact Mass | 591.07 |
| IUPAC Name | 5-[(Z)-1-aminooxy-3-[2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-3-yl]prop-1-enyl]-N-(1-carbamothioylcyclopropyl)-2-chlorobenzamide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1C/C=C(\ON)c1ccc(Cl)c(C(=O)NC2(C(N)=S)CC2)c1 |
| InChI | InChI=1S/C21H18ClF8N5O2S/c1-35-12(14(20(25,26)27)15(34-35)19(23,24)21(28,29)30)4-5-13(37-32)9-2-3-11(22)10(8-9)16(36)33-18(6-7-18)17(31)38/h2-3,5,8H,4,6-7,32H2,1H3,(H2,31,38)(H,33,36)/b13-5- |
| InChIKey | RKMOEVZTXYOTBS-ACAGNQJTSA-N |
| XLogP | 4.77 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.91 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|