C22H19ClF10N6O2 — CID 149104201
N-(1-aminocyclopropyl)-5-[1-amino-3-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]iminoprop-1-en-2-yl]-2-chlorobenzamide (PubChem CID 149104201) has the molecular formula C22H19ClF10N6O2 and a molecular weight of 624.87 g/mol. Its IUPAC name is N-(1-aminocyclopropyl)-5-[1-amino-3-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]iminoprop-1-en-2-yl]-2-chlorobenzamide.
| Compound Name | N-(1-aminocyclopropyl)-5-[1-amino-3-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]iminoprop-1-en-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 149104201 |
| Molecular Formula | C22H19ClF10N6O2 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.11 |
| IUPAC Name | N-(1-aminocyclopropyl)-5-[1-amino-3-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)-1-methyl-4-(trifluoromethyl)pyrazol-5-yl]iminoprop-1-en-2-yl]-2-chlorobenzamide |
| SMILES | Cn1nc(OCC(F)(F)C(F)(F)C(F)(F)F)c(C(F)(F)F)c1N=CC(=CN)c1ccc(Cl)c(C(=O)NC2(N)CC2)c1 |
| InChI | InChI=1S/C22H19ClF10N6O2/c1-39-15(14(20(26,27)28)17(38-39)41-9-19(24,25)21(29,30)22(31,32)33)36-8-11(7-34)10-2-3-13(23)12(6-10)16(40)37-18(35)4-5-18/h2-3,6-8H,4-5,9,34-35H2,1H3,(H,37,40) |
| InChIKey | VKPJWFYDHCXWFE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|