C26H25ClF8N6O2 — CID 162611584
5-[1-amino-3-[4-(1-fluoroethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]iminoprop-1-en-2-yl]-2-chloro-N-(1-cyanocyclopropyl)-N-propan-2-ylbenzamide (PubChem CID 162611584) has the molecular formula C26H25ClF8N6O2 and a molecular weight of 640.96 g/mol. Its IUPAC name is 5-[1-amino-3-[4-(1-fluoroethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]iminoprop-1-en-2-yl]-2-chloro-N-(1-cyanocyclopropyl)-N-propan-2-ylbenzamide.
| Compound Name | 5-[1-amino-3-[4-(1-fluoroethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]iminoprop-1-en-2-yl]-2-chloro-N-(1-cyanocyclopropyl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 162611584 |
| Molecular Formula | C26H25ClF8N6O2 |
| Molecular Weight | 640.96 g/mol |
| Exact Mass | 640.16 |
| IUPAC Name | 5-[1-amino-3-[4-(1-fluoroethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]iminoprop-1-en-2-yl]-2-chloro-N-(1-cyanocyclopropyl)-N-propan-2-ylbenzamide |
| SMILES | CC(F)Oc1c(C(F)(C(F)(F)F)C(F)(F)F)nn(C)c1N=CC(=CN)c1ccc(Cl)c(C(=O)N(C(C)C)C2(C#N)CC2)c1 |
| InChI | InChI=1S/C26H25ClF8N6O2/c1-13(2)41(23(12-37)7-8-23)22(42)17-9-15(5-6-18(17)27)16(10-36)11-38-21-19(43-14(3)28)20(39-40(21)4)24(29,25(30,31)32)26(33,34)35/h5-6,9-11,13-14H,7-8,36H2,1-4H3 |
| InChIKey | IQZINETYOPJWLH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 109.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.96 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|