C25H20ClF9N6O4 — CID 162611587
ethyl N-[5-[1-amino-3-[4-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]iminoprop-1-en-2-yl]-2-chlorobenzoyl]-N-(1-cyanocyclopropyl)carbamate (PubChem CID 162611587) has the molecular formula C25H20ClF9N6O4 and a molecular weight of 674.91 g/mol. Its IUPAC name is ethyl N-[5-[1-amino-3-[4-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]iminoprop-1-en-2-yl]-2-chlorobenzoyl]-N-(1-cyanocyclopropyl)carbamate.
| Compound Name | ethyl N-[5-[1-amino-3-[4-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]iminoprop-1-en-2-yl]-2-chlorobenzoyl]-N-(1-cyanocyclopropyl)carbamate |
|---|---|
| PubChem CID | 162611587 |
| Molecular Formula | C25H20ClF9N6O4 |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 674.11 |
| IUPAC Name | ethyl N-[5-[1-amino-3-[4-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]iminoprop-1-en-2-yl]-2-chlorobenzoyl]-N-(1-cyanocyclopropyl)carbamate |
| SMILES | CCOC(=O)N(C(=O)c1cc(C(C=Nc2c(OC(F)F)c(C(F)(C(F)(F)F)C(F)(F)F)nn2C)=CN)ccc1Cl)C1(C#N)CC1 |
| InChI | InChI=1S/C25H20ClF9N6O4/c1-3-44-21(43)41(22(11-37)6-7-22)19(42)14-8-12(4-5-15(14)26)13(9-36)10-38-18-16(45-20(27)28)17(39-40(18)2)23(29,24(30,31)32)25(33,34)35/h4-5,8-10,20H,3,6-7,36H2,1-2H3 |
| InChIKey | NDUCFUFANFIZBZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|