C21H17ClF5N5O2S — CID 160678047
2-chloro-N-(1-cyanocyclopropyl)-5-[3-[1,4-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-ethylthiophene-3-carboxamide (PubChem CID 160678047) has the molecular formula C21H17ClF5N5O2S and a molecular weight of 533.91 g/mol. Its IUPAC name is 2-chloro-N-(1-cyanocyclopropyl)-5-[3-[1,4-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-ethylthiophene-3-carboxamide.
| Compound Name | 2-chloro-N-(1-cyanocyclopropyl)-5-[3-[1,4-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-ethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 160678047 |
| Molecular Formula | C21H17ClF5N5O2S |
| Molecular Weight | 533.91 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | 2-chloro-N-(1-cyanocyclopropyl)-5-[3-[1,4-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]-N-ethylthiophene-3-carboxamide |
| SMILES | CCN(C(=O)c1cc(-c2cc(-c3c(C)c(C(F)(F)C(F)(F)F)nn3C)no2)sc1Cl)C1(C#N)CC1 |
| InChI | InChI=1S/C21H17ClF5N5O2S/c1-4-32(19(9-28)5-6-19)18(33)11-7-14(35-17(11)22)13-8-12(30-34-13)15-10(2)16(29-31(15)3)20(23,24)21(25,26)27/h7-8H,4-6H2,1-3H3 |
| InChIKey | RNTYCFKZVLEZAA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 87.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.91 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|