C19H15ClF8N4O2 — CID 167067629
[2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]phenyl]-(ethylamino)methanol (PubChem CID 167067629) has the molecular formula C19H15ClF8N4O2 and a molecular weight of 518.79 g/mol. Its IUPAC name is [2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]phenyl]-(ethylamino)methanol.
| Compound Name | [2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]phenyl]-(ethylamino)methanol |
|---|---|
| PubChem CID | 167067629 |
| Molecular Formula | C19H15ClF8N4O2 |
| Molecular Weight | 518.79 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | [2-chloro-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]phenyl]-(ethylamino)methanol |
| SMILES | CCNC(O)c1cc(-c2cc(-c3c(C(F)(F)F)c(C(F)(F)C(F)(F)F)nn3C)no2)ccc1Cl |
| InChI | InChI=1S/C19H15ClF8N4O2/c1-3-29-16(33)9-6-8(4-5-10(9)20)12-7-11(31-34-12)14-13(18(23,24)25)15(30-32(14)2)17(21,22)19(26,27)28/h4-7,16,29,33H,3H2,1-2H3 |
| InChIKey | CGNVFBSCSZHHDB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.79 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|