C20H13ClF8N4O2 — CID 126498372
2-chloro-N-cyclopropyl-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]benzamide (PubChem CID 126498372) has the molecular formula C20H13ClF8N4O2 and a molecular weight of 528.79 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 126498372 |
| Molecular Formula | C20H13ClF8N4O2 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-[3-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,2-oxazol-5-yl]benzamide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-c1cc(-c2ccc(Cl)c(C(=O)NC3CC3)c2)on1 |
| InChI | InChI=1S/C20H13ClF8N4O2/c1-33-15(14(19(24,25)26)16(31-33)18(22,23)20(27,28)29)12-7-13(35-32-12)8-2-5-11(21)10(6-8)17(34)30-9-3-4-9/h2,5-7,9H,3-4H2,1H3,(H,30,34) |
| InChIKey | RINPCBQHISEBRK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|