C28H33BF3NO3S — CID 142450924
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]-N-(2,4,6-trimethylphenyl)sulfanylmethanamine (PubChem CID 142450924) has the molecular formula C28H33BF3NO3S and a molecular weight of 531.45 g/mol. Its IUPAC name is 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]-N-(2,4,6-trimethylphenyl)sulfanylmethanamine.
| Compound Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]-N-(2,4,6-trimethylphenyl)sulfanylmethanamine |
|---|---|
| PubChem CID | 142450924 |
| Molecular Formula | C28H33BF3NO3S |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]-N-(2,4,6-trimethylphenyl)sulfanylmethanamine |
| SMILES | Cc1cc(C)c(SN(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)Cc2ccc(C(F)(F)F)o2)c(C)c1 |
| InChI | InChI=1S/C28H33BF3NO3S/c1-18-14-19(2)25(20(3)15-18)37-33(17-23-12-13-24(34-23)28(30,31)32)16-21-8-10-22(11-9-21)29-35-26(4,5)27(6,7)36-29/h8-15H,16-17H2,1-7H3 |
| InChIKey | QULXHFCMNQILID-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|