C37H40BBrF3NO7 — CID 160509612
2-(3-bromophenoxy)acetic acid;2,4,6-trimethyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]benzamide (PubChem CID 160509612) has the molecular formula C37H40BBrF3NO7 and a molecular weight of 758.44 g/mol. Its IUPAC name is 2-(3-bromophenoxy)acetic acid;2,4,6-trimethyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]benzamide.
| Compound Name | 2-(3-bromophenoxy)acetic acid;2,4,6-trimethyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 160509612 |
| Molecular Formula | C37H40BBrF3NO7 |
| Molecular Weight | 758.44 g/mol |
| Exact Mass | 757.20 |
| IUPAC Name | 2-(3-bromophenoxy)acetic acid;2,4,6-trimethyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-N-[[5-(trifluoromethyl)furan-2-yl]methyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)N(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)Cc2ccc(C(F)(F)F)o2)c(C)c1.O=C(O)COc1cccc(Br)c1 |
| InChI | InChI=1S/C29H33BF3NO4.C8H7BrO3/c1-18-14-19(2)25(20(3)15-18)26(35)34(17-23-12-13-24(36-23)29(31,32)33)16-21-8-10-22(11-9-21)30-37-27(4,5)28(6,7)38-30;9-6-2-1-3-7(4-6)12-5-8(10)11/h8-15H,16-17H2,1-7H3;1-4H,5H2,(H,10,11) |
| InChIKey | QSWJBTULCUBSHR-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.44 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|