C26H35FN2O2Si — CID 142455427
[(4aS)-1-(4-fluorophenyl)-6-(methoxymethylidene)-4,5,7,8-tetrahydrobenzo[f]indazol-4a-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 142455427) has the molecular formula C26H35FN2O2Si and a molecular weight of 454.66 g/mol. Its IUPAC name is [(4aS)-1-(4-fluorophenyl)-6-(methoxymethylidene)-4,5,7,8-tetrahydrobenzo[f]indazol-4a-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aS)-1-(4-fluorophenyl)-6-(methoxymethylidene)-4,5,7,8-tetrahydrobenzo[f]indazol-4a-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 142455427 |
| Molecular Formula | C26H35FN2O2Si |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [(4aS)-1-(4-fluorophenyl)-6-(methoxymethylidene)-4,5,7,8-tetrahydrobenzo[f]indazol-4a-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COC=C1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@]2(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H35FN2O2Si/c1-25(2,3)32(5,6)31-18-26-14-19(17-30-4)7-8-21(26)13-24-20(15-26)16-28-29(24)23-11-9-22(27)10-12-23/h9-13,16-17H,7-8,14-15,18H2,1-6H3/t26-/m0/s1 |
| InChIKey | WNGFKTVJPOXIJU-SANMLTNESA-N |
| XLogP | 6.67 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|