C22H25FN2O2 — CID 142958318
ethane;methyl (2E)-2-[1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ylidene]acetate (PubChem CID 142958318) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is ethane;methyl (2E)-2-[1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ylidene]acetate.
| Compound Name | ethane;methyl (2E)-2-[1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ylidene]acetate |
|---|---|
| PubChem CID | 142958318 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | ethane;methyl (2E)-2-[1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ylidene]acetate |
| SMILES | CC.COC(=O)/C=C1\CCC2=Cc3c(cnn3-c3ccc(F)cc3)CC21C |
| InChI | InChI=1S/C20H19FN2O2.C2H6/c1-20-11-13-12-22-23(17-7-5-16(21)6-8-17)18(13)9-14(20)3-4-15(20)10-19(24)25-2;1-2/h5-10,12H,3-4,11H2,1-2H3;1-2H3/b15-10+; |
| InChIKey | QIGBTGKTUMEUTQ-GYVLLFFHSA-N |
| XLogP | 4.88 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|