C19H18FN5O2 — CID 142456105
methyl (4aS,6S)-6-azido-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazole-4a-carboxylate (PubChem CID 142456105) has the molecular formula C19H18FN5O2 and a molecular weight of 367.38 g/mol. Its IUPAC name is methyl (4aS,6S)-6-azido-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazole-4a-carboxylate.
| Compound Name | methyl (4aS,6S)-6-azido-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazole-4a-carboxylate |
|---|---|
| PubChem CID | 142456105 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl (4aS,6S)-6-azido-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazole-4a-carboxylate |
| SMILES | COC(=O)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CC[C@H](N=[N+]=[N-])C2 |
| InChI | InChI=1S/C19H18FN5O2/c1-27-18(26)19-9-12-11-22-25(16-6-3-14(20)4-7-16)17(12)8-13(19)2-5-15(10-19)23-24-21/h3-4,6-8,11,15H,2,5,9-10H2,1H3/t15-,19-/m0/s1 |
| InChIKey | LDHWFDUVQSASLO-KXBFYZLASA-N |
| XLogP | 3.97 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|