C28H41N3O3S — CID 142456656
[(1S)-1-butyl-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 142456656) has the molecular formula C28H41N3O3S and a molecular weight of 499.72 g/mol. Its IUPAC name is [(1S)-1-butyl-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate.
| Compound Name | [(1S)-1-butyl-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 142456656 |
| Molecular Formula | C28H41N3O3S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | [(1S)-1-butyl-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | CCCC[C@@]12CCN(C)C(Cc3ccc(OC(=O)CCCCC4SCC5NC(=O)NC54)cc31)C2C |
| InChI | InChI=1S/C28H41N3O3S/c1-4-5-12-28-13-14-31(3)23(18(28)2)15-19-10-11-20(16-21(19)28)34-25(32)9-7-6-8-24-26-22(17-35-24)29-27(33)30-26/h10-11,16,18,22-24,26H,4-9,12-15,17H2,1-3H3,(H2,29,30,33)/t18?,22?,23?,24?,26?,28-/m0/s1 |
| InChIKey | ADWFHGRBEDHCRH-GXCBWGAZSA-N |
| XLogP | 4.64 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|