C13H24N2S — CID 142457781
1-[(2Z,4E)-hepta-2,4-dien-4-yl]sulfanyl-N-methylpiperidin-4-amine (PubChem CID 142457781) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 1-[(2Z,4E)-hepta-2,4-dien-4-yl]sulfanyl-N-methylpiperidin-4-amine.
| Compound Name | 1-[(2Z,4E)-hepta-2,4-dien-4-yl]sulfanyl-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 142457781 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-[(2Z,4E)-hepta-2,4-dien-4-yl]sulfanyl-N-methylpiperidin-4-amine |
| SMILES | C/C=C\C(=C/CC)SN1CCC(NC)CC1 |
| InChI | InChI=1S/C13H24N2S/c1-4-6-13(7-5-2)16-15-10-8-12(14-3)9-11-15/h4,6-7,12,14H,5,8-11H2,1-3H3/b6-4-,13-7+ |
| InChIKey | WNSGHAROWMVBEC-FMEHWCPISA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|