C15H22N4S2 — CID 142460560
2-[2-(4-benzyltriazol-1-yl)ethyldisulfanyl]-N,N-dimethylethanamine (PubChem CID 142460560) has the molecular formula C15H22N4S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 2-[2-(4-benzyltriazol-1-yl)ethyldisulfanyl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(4-benzyltriazol-1-yl)ethyldisulfanyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 142460560 |
| Molecular Formula | C15H22N4S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-[2-(4-benzyltriazol-1-yl)ethyldisulfanyl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCSSCCn1cc(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C15H22N4S2/c1-18(2)8-10-20-21-11-9-19-13-15(16-17-19)12-14-6-4-3-5-7-14/h3-7,13H,8-12H2,1-2H3 |
| InChIKey | UEGQHKLEOGFEGX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|