C33H44N6O3 — CID 142467193
tert-butyl 4-[[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzoyl]amino]piperidine-1-carboxylate (PubChem CID 142467193) has the molecular formula C33H44N6O3 and a molecular weight of 572.75 g/mol. Its IUPAC name is tert-butyl 4-[[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142467193 |
| Molecular Formula | C33H44N6O3 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | tert-butyl 4-[[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2ccc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)cc2)CC1 |
| InChI | InChI=1S/C33H44N6O3/c1-33(2,3)42-32(41)39-20-13-26(14-21-39)36-31(40)25-10-8-24(9-11-25)29-22-30(27-23-34-16-12-28(27)37-29)35-15-7-19-38-17-5-4-6-18-38/h8-12,16,22-23,26H,4-7,13-15,17-21H2,1-3H3,(H,35,37)(H,36,40) |
| InChIKey | PPTORCYZRIVPDU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|