C10H16N4O3S — CID 142470641
tert-butyl N-[2-[[(hydroxyamino)methylideneamino]methyl]-1,3-thiazol-4-yl]carbamate (PubChem CID 142470641) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is tert-butyl N-[2-[[(hydroxyamino)methylideneamino]methyl]-1,3-thiazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-[[(hydroxyamino)methylideneamino]methyl]-1,3-thiazol-4-yl]carbamate |
|---|---|
| PubChem CID | 142470641 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | tert-butyl N-[2-[[(hydroxyamino)methylideneamino]methyl]-1,3-thiazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1csc(C/N=C/NO)n1 |
| InChI | InChI=1S/C10H16N4O3S/c1-10(2,3)17-9(15)14-7-5-18-8(13-7)4-11-6-12-16/h5-6,16H,4H2,1-3H3,(H,11,12)(H,14,15) |
| InChIKey | XMBYJEKVZXXCAH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|