C42H35FN6S — CID 142471778
2-[5-benzylsulfanyl-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]-5-fluoro-1H-indole (PubChem CID 142471778) has the molecular formula C42H35FN6S and a molecular weight of 674.85 g/mol. Its IUPAC name is 2-[5-benzylsulfanyl-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]-5-fluoro-1H-indole.
| Compound Name | 2-[5-benzylsulfanyl-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]-5-fluoro-1H-indole |
|---|---|
| PubChem CID | 142471778 |
| Molecular Formula | C42H35FN6S |
| Molecular Weight | 674.85 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | 2-[5-benzylsulfanyl-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]-5-fluoro-1H-indole |
| SMILES | Fc1ccc2[nH]c(-c3nnc(SCc4ccccc4)n3CCCc3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)cc2c1 |
| InChI | InChI=1S/C42H35FN6S/c43-36-23-24-38-32(26-36)27-39(45-38)40-46-47-41(50-29-31-14-5-1-6-15-31)49(40)25-13-22-37-28-48(30-44-37)42(33-16-7-2-8-17-33,34-18-9-3-10-19-34)35-20-11-4-12-21-35/h1-12,14-21,23-24,26-28,30,45H,13,22,25,29H2 |
| InChIKey | SDMGUFMQTAVRRJ-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.85 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|