C44H38Cl2N6S — CID 142471690
3-[2-[5-[(3,4-dichlorophenyl)methylsulfanyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]ethyl]-1H-indole (PubChem CID 142471690) has the molecular formula C44H38Cl2N6S and a molecular weight of 753.80 g/mol. Its IUPAC name is 3-[2-[5-[(3,4-dichlorophenyl)methylsulfanyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]ethyl]-1H-indole.
| Compound Name | 3-[2-[5-[(3,4-dichlorophenyl)methylsulfanyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]ethyl]-1H-indole |
|---|---|
| PubChem CID | 142471690 |
| Molecular Formula | C44H38Cl2N6S |
| Molecular Weight | 753.80 g/mol |
| Exact Mass | 752.23 |
| IUPAC Name | 3-[2-[5-[(3,4-dichlorophenyl)methylsulfanyl]-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]ethyl]-1H-indole |
| SMILES | Clc1ccc(CSc2nnc(CCc3c[nH]c4ccccc34)n2CCCc2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)cc1Cl |
| InChI | InChI=1S/C44H38Cl2N6S/c45-39-24-22-32(27-40(39)46)30-53-43-50-49-42(25-23-33-28-47-41-21-11-10-20-38(33)41)52(43)26-12-19-37-29-51(31-48-37)44(34-13-4-1-5-14-34,35-15-6-2-7-16-35)36-17-8-3-9-18-36/h1-11,13-18,20-22,24,27-29,31,47H,12,19,23,25-26,30H2 |
| InChIKey | ITKMCSKCKXPAOB-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.80 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|