C41H41FN6 — CID 142471855
3-[[5-(2,2-dimethylpropyl)-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-6-fluoro-1H-indole (PubChem CID 142471855) has the molecular formula C41H41FN6 and a molecular weight of 636.82 g/mol. Its IUPAC name is 3-[[5-(2,2-dimethylpropyl)-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-6-fluoro-1H-indole.
| Compound Name | 3-[[5-(2,2-dimethylpropyl)-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-6-fluoro-1H-indole |
|---|---|
| PubChem CID | 142471855 |
| Molecular Formula | C41H41FN6 |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | 3-[[5-(2,2-dimethylpropyl)-4-[3-(1-tritylimidazol-4-yl)propyl]-1,2,4-triazol-3-yl]methyl]-6-fluoro-1H-indole |
| SMILES | CC(C)(C)Cc1nnc(Cc2c[nH]c3cc(F)ccc23)n1CCCc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C41H41FN6/c1-40(2,3)26-39-46-45-38(24-30-27-43-37-25-34(42)21-22-36(30)37)48(39)23-13-20-35-28-47(29-44-35)41(31-14-7-4-8-15-31,32-16-9-5-10-17-32)33-18-11-6-12-19-33/h4-12,14-19,21-22,25,27-29,43H,13,20,23-24,26H2,1-3H3 |
| InChIKey | IXVFPEFMSBSJJB-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|