C37H36N6OS — CID 146586128
1-[3-(1H-indol-3-yl)propanoylamino]-3-[3-(1-tritylimidazol-4-yl)propyl]thiourea (PubChem CID 146586128) has the molecular formula C37H36N6OS and a molecular weight of 612.80 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propanoylamino]-3-[3-(1-tritylimidazol-4-yl)propyl]thiourea.
| Compound Name | 1-[3-(1H-indol-3-yl)propanoylamino]-3-[3-(1-tritylimidazol-4-yl)propyl]thiourea |
|---|---|
| PubChem CID | 146586128 |
| Molecular Formula | C37H36N6OS |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propanoylamino]-3-[3-(1-tritylimidazol-4-yl)propyl]thiourea |
| SMILES | O=C(CCc1c[nH]c2ccccc12)NNC(=S)NCCCc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C37H36N6OS/c44-35(23-22-28-25-39-34-21-11-10-20-33(28)34)41-42-36(45)38-24-12-19-32-26-43(27-40-32)37(29-13-4-1-5-14-29,30-15-6-2-7-16-30)31-17-8-3-9-18-31/h1-11,13-18,20-21,25-27,39H,12,19,22-24H2,(H,41,44)(H2,38,42,45) |
| InChIKey | XLWBQLKQZAYBLF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|