C20H14N2O2S2 — CID 142472277
1-(4-methylphenyl)sulfonyl-3-thiophen-3-ylindole-5-carbonitrile (PubChem CID 142472277) has the molecular formula C20H14N2O2S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-thiophen-3-ylindole-5-carbonitrile.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-thiophen-3-ylindole-5-carbonitrile |
|---|---|
| PubChem CID | 142472277 |
| Molecular Formula | C20H14N2O2S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-thiophen-3-ylindole-5-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccsc3)c3cc(C#N)ccc32)cc1 |
| InChI | InChI=1S/C20H14N2O2S2/c1-14-2-5-17(6-3-14)26(23,24)22-12-19(16-8-9-25-13-16)18-10-15(11-21)4-7-20(18)22/h2-10,12-13H,1H3 |
| InChIKey | FOYDZKAPVYIMIP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |